| EC Number | 207-542-9 |
|---|---|
| UNSPSC Code | 12171500 |
| NACRES | NA.47 |
| PubChem Substance ID | 24885989 |
| MDL number | MFCD00017307 |
| Colour Index Number | 75660 |
| Beilstein/REAXYS Number | 327474 |
| InChI key | MYUBTSPIIFYCIU-UHFFFAOYSA-N |
| InChI | 1S/C15H10O7.H2O/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15;/h1-5,16-19,21H;1H2 |
| SMILES string | O=C1C(O)=C(C2=CC=CC=C2O)OC3=CC(O)=CC(O)=C31 |
| assay | ≥85% (HPLC) |
| form | powder |
| quality | for the determination of Al, Be, Zn, Ga, In, Sc |
| technique(s) | titration: suitable |
| impurities | 1-2 mol/mol water |
| mp | 299-300 °C |
| solubility | methanol: 0.5 g/10 mL, brown |
| ε<sub>max</sub> | ≥300 at 360-375 nm in methanol |
| suitability | suitable for microscopy |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| storage temp. | room temp |
| Quality Level | 200 |
| Gene Information | human ... CYP1A2(1544) |
